163734-01-8 Usage
General Description
Phenol, 2-amino-4,5-difluoro- (9CI) is a chemical compound that belongs to the class of phenols, which are aromatic compounds containing a hydroxyl group directly attached to an aromatic hydrocarbon group. This specific compound contains two amino groups and two difluoromethyl groups attached to a phenolic ring. It is used in various research and laboratory applications, including as a building block in the synthesis of more complex organic compounds. It may also have potential applications in the pharmaceutical and agrochemical industries due to its unique structure and properties. However, its specific uses and potential hazards should be thoroughly evaluated before handling or using this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 163734-01-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,3,7,3 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 163734-01:
(8*1)+(7*6)+(6*3)+(5*7)+(4*3)+(3*4)+(2*0)+(1*1)=128
128 % 10 = 8
So 163734-01-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H5F2NO/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H,9H2
