164298-25-3 Usage
Description
BIS(TETRAMETHYLENE)FLUOROFORMAMIDINIUM HEXAFLUOROPHOSPHATE is a white to off-white solid that is used as a reagent for the synthesis of immonium-type coupling reagents. It is a chemical compound with a complex structure, consisting of a fluoroformamidinium cation and a hexafluorophosphate anion, connected through a bis(tetramethylene) bridge.
Uses
Used in Pharmaceutical Industry:
BIS(TETRAMETHYLENE)FLUOROFORMAMIDINIUM HEXAFLUOROPHOSPHATE is used as a reagent for the synthesis of immonium-type coupling reagents, which are important intermediates in the development of various pharmaceutical compounds. The compound's unique structure allows it to facilitate the formation of these reagents, enabling the creation of new drugs with potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, BIS(TETRAMETHYLENE)FLUOROFORMAMIDINIUM HEXAFLUOROPHOSPHATE is used as a reagent for the synthesis of immonium-type coupling reagents. This allows researchers to explore new chemical reactions and develop innovative synthetic methods, contributing to the advancement of chemical science and technology.
Used in Material Science:
BIS(TETRAMETHYLENE)FLUOROFORMAMIDINIUM HEXAFLUOROPHOSPHATE may also find applications in material science, where its unique properties can be utilized to develop new materials with specific characteristics. The compound's ability to act as a reagent for the synthesis of immonium-type coupling reagents could be harnessed to create novel materials with potential applications in various industries, such as electronics, aerospace, and automotive.
Check Digit Verification of cas no
The CAS Registry Mumber 164298-25-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,4,2,9 and 8 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 164298-25:
(8*1)+(7*6)+(6*4)+(5*2)+(4*9)+(3*8)+(2*2)+(1*5)=153
153 % 10 = 3
So 164298-25-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H16FN2.F6P/c10-9(11-5-1-2-6-11)12-7-3-4-8-12;1-7(2,3,4,5)6/h1-8H2;/q+1;-1
