207399-20-0 Usage
Description
N1-Isopropyldiethylenetriamine TECH., also known as N1-Isopropyl-1,4-diaza-7-phosphabicyclo[2.2.1]heptane, is a polyamine compound that serves as a crucial organic building block in various organic synthesis processes. It is characterized by its unique molecular structure, which contributes to its diverse applications across different industries.
Uses
Used in Pharmaceutical Industry:
N1-Isopropyldiethylenetriamine TECH. is used as a synthetic intermediate for the development of various pharmaceutical compounds. Its unique molecular structure allows it to be a versatile building block in the synthesis of drugs with potential therapeutic applications.
Used in Chemical Industry:
In the chemical industry, N1-Isopropyldiethylenetriamine TECH. is utilized as a key component in the production of various chemicals, including surfactants, corrosion inhibitors, and additives. Its ability to form stable complexes with metal ions makes it a valuable additive in the formulation of industrial products.
Used in Agrochemical Industry:
N1-Isopropyldiethylenetriamine TECH. is employed as a chelating agent in the agrochemical industry, where it helps to improve the efficiency of fertilizers and pesticides by forming stable complexes with metal ions present in the soil.
Used in Research and Development:
Due to its unique properties and potential for various applications, N1-Isopropyldiethylenetriamine TECH. is also used in research and development laboratories for the synthesis of novel compounds and the exploration of new chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 207399-20-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,7,3,9 and 9 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 207399-20:
(8*2)+(7*0)+(6*7)+(5*3)+(4*9)+(3*9)+(2*2)+(1*0)=140
140 % 10 = 0
So 207399-20-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H19N3/c1-7(2)10-6-5-9-4-3-8/h7,9-10H,3-6,8H2,1-2H3
207399-20-0Relevant articles and documents
AMINE COMPOSITION USEFUL FOR MAKING STABLE POLYURETHANE FOAM SYSTEMS
-
Paragraph 00110, (2020/09/12)
Acatalyst composition comprising at least one compound with a general formula (I) wherein A is N-R3, R3 is C1-C8 linear or branched, x = 0-6, n and m are each independently 1 to 6, R1 and R2 are each independently C2 -C8 alkyl, and R4 and R5 are -CH3 groups; or A = O, x = 0-6, n and m are each independently 1 to 6, R1 and R 2 are each independently C2-C8 alkyl, and R4 and R5 are -CH3 groups; or A = O or N-R3, R3 is C1-C8 linear or branched, and N(R1---R4) and N(R2---R5) each independently represent a C3-C7 ring amine moiety of the type: (II).