53078-35-6 Usage
Description
2-Bromo-5-methylaniline, also known as 2-BroMo-5-Methylaniline, is a chemical compound with the molecular formula C7H8BrN. It is a brominated derivative of aniline, featuring a benzene ring with a methyl group and a bromine atom attached to it. 2-BroMo-5-Methylaniline is recognized for its role in organic synthesis and its potential applications across various industries.
Uses
Used in Pharmaceutical Industry:
2-BroMo-5-Methylaniline is used as a building block for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, contributing to the advancement of medical treatments.
Used in Agrochemical Industry:
In the agrochemical sector, 2-BroMo-5-Methylaniline serves as an intermediate in the production of pesticides and other agricultural chemicals. Its properties make it suitable for creating compounds that can protect crops and enhance agricultural productivity.
Used in Dye Industry:
2-BroMo-5-Methylaniline is utilized as a starting material for the creation of different dyes. Its chemical structure enables the production of a wide range of colors, which are essential in various applications such as textiles, printing, and painting.
Used in Chemical Production:
As an intermediate in the production of other chemicals, 2-BroMo-5-Methylaniline plays a crucial role in various industrial processes. Its versatility allows it to be a part of the synthesis of numerous chemical compounds used in multiple industries.
Check Digit Verification of cas no
The CAS Registry Mumber 53078-35-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,0,7 and 8 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 53078-35:
(7*5)+(6*3)+(5*0)+(4*7)+(3*8)+(2*3)+(1*5)=116
116 % 10 = 6
So 53078-35-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8BrN/c1-5-2-3-6(8)7(9)4-5/h2-4H,9H2,1H3
