62357-86-2 Usage
Description
Desmopressin Acetate, also known as the trihydrate of the acetic acid salt of desmopressin, is an antidiuretic hormone analog that plays a crucial role in regulating the body's water balance. It increases urine concentration and decreases urine production, making it a valuable pharmaceutical compound for various medical applications.
Uses
Used in Medical Applications:
Desmopressin Acetate is used as a therapeutic agent for managing excessive thirst, urination, and dehydration caused by injury, surgery, and certain medical conditions. It helps in maintaining the body's water balance and preventing complications associated with fluid imbalance.
Used in Diagnosis and Treatment of Cranial Diabetes Insipidus:
In the medical industry, Desmopressin Acetate is used as a diagnostic and treatment tool for cranial diabetes insipidus, a condition characterized by the inability to regulate the body's water balance, leading to excessive thirst and urination.
Used in Renal Function Tests:
Desmopressin Acetate is also utilized as a diagnostic agent in tests of renal function, helping healthcare professionals assess the efficiency of a patient's kidneys in filtering and maintaining the body's water balance.
Check Digit Verification of cas no
The CAS Registry Mumber 62357-86-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,3,5 and 7 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 62357-86:
(7*6)+(6*2)+(5*3)+(4*5)+(3*7)+(2*8)+(1*6)=132
132 % 10 = 2
So 62357-86-2 is a valid CAS Registry Number.
InChI:InChI=1/C46H64N14O12S2.C2H4O2.3H2O/c47-35(62)15-14-29-40(67)58-32(22-36(48)63)43(70)59-33(45(72)60-18-5-9-34(60)44(71)56-28(8-4-17-52-46(50)51)39(66)53-23-37(49)64)24-74-73-19-16-38(65)54-30(21-26-10-12-27(61)13-11-26)41(68)57-31(42(69)55-29)20-25-6-2-1-3-7-25;1-2(3)4;;;/h1-3,6-7,10-13,28-34,61H,4-5,8-9,14-24H2,(H2,47,62)(H2,48,63)(H2,49,64)(H,53,66)(H,54,65)(H,55,69)(H,56,71)(H,57,68)(H,58,67)(H,59,70)(H4,50,51,52);1H3,(H,3,4);3*1H2