78113-36-7 Usage
Description
AC-MURAMYL-ALA-D-GLU(LYS(STEAROYL)-OH)-NH2 is a synthetic compound that is a derivative of the naturally occurring muramyl dipeptide (MDP). It is characterized by the presence of a stearyl group attached to a lysine residue, which is part of a larger peptide structure. This modification enhances the compound's properties and potential applications in various fields.
Used in Pharmaceutical Industry:
AC-MURAMYL-ALA-D-GLU(LYS(STEAROYL)-OH)-NH2 is used as an immunomodulator for enhancing the immune response against infections and malignancies. Its lipophilic nature, due to the stearyl group, allows for better cell membrane penetration and increased bioavailability, making it a promising candidate for the development of immunotherapies.
Used in Anticancer Applications:
In the field of oncology, AC-MURAMYL-ALA-D-GLU(LYS(STEAROYL)-OH)-NH2 is used as an anticancer agent, particularly for the treatment of solid tumors. It has the potential to modulate various oncological signaling pathways, leading to the inhibition of tumor growth and progression. Additionally, it may demonstrate synergistic anticancer effects when combined with conventional chemotherapeutic drugs, enhancing chemo-sensitivity and efficacy in resistant cases.
Used in Drug Delivery Systems:
To overcome potential limitations of AC-MURAMYL-ALA-D-GLU(LYS(STEAROYL)-OH)-NH2, such as solubility and stability issues, novel drug delivery systems have been developed. These systems, which may include organic and metallic nanoparticles, serve as carriers for the compound, aiming to improve its delivery, bioavailability, and therapeutic outcomes.
Used in Wound Healing Applications:
AC-MURAMYL-ALA-D-GLU(LYS(STEAROYL)-OH)-NH2 is used as a wound healing agent, promoting tissue repair and regeneration. Its immunomodulatory properties can contribute to the enhancement of the body's natural healing processes, making it a valuable component in the development of advanced wound care products.
Check Digit Verification of cas no
The CAS Registry Mumber 78113-36-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,1,1 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 78113-36:
(7*7)+(6*8)+(5*1)+(4*1)+(3*3)+(2*3)+(1*6)=127
127 % 10 = 7
So 78113-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C43H78N6O13/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-34(52)45-26-21-20-22-32(42(58)59)48-35(53)25-24-31(39(44)55)49-40(56)28(2)46-41(57)29(3)61-38-36(47-30(4)51)43(60)62-33(27-50)37(38)54/h28-29,31-33,36-38,43,50,54,60H,5-27H2,1-4H3,(H2,44,55)(H,45,52)(H,46,57)(H,47,51)(H,48,53)(H,49,56)(H,58,59)/t28-,29+,31+,32+,33+,36+,37+,38+,43?/m0/s1