98815-38-4 Usage
Description
TYR-D-ALA-PHE-D-ALA-TYR-NH2 is a peptide compound composed of five amino acids, including tyrosine, alanine, phenylalanine, and two additional alanine residues, with an amide group at the end. This specific sequence of amino acids endows the peptide with unique biological or chemical properties, which may be explored for various applications in research, medicine, or industry.
Uses
Used in Research Applications:
TYR-D-ALA-PHE-D-ALA-TYR-NH2 is used as a research tool for studying the structure, function, and interactions of peptides in biological systems. Its unique amino acid sequence may provide insights into peptide behavior and contribute to the development of new therapeutic agents or diagnostic tools.
Used in Pharmaceutical Development:
In the pharmaceutical industry, TYR-D-ALA-PHE-D-ALA-TYR-NH2 may be utilized as a potential therapeutic agent or as a lead compound for the development of new drugs. Its specific amino acid arrangement could offer targeted effects on biological processes or pathways, leading to the treatment or management of various diseases or conditions.
Used in Diagnostic Applications:
TYR-D-ALA-PHE-D-ALA-TYR-NH2 may also be employed in diagnostic applications, where its unique properties can be leveraged to detect or monitor specific biological markers or processes. This could include the development of assays, sensors, or imaging agents that utilize the peptide's interactions with target molecules or cells.
Used in Industrial Applications:
In the industrial sector, TYR-D-ALA-PHE-D-ALA-TYR-NH2 may find use in various applications, such as in the development of biomaterials, enzymes, or other biotechnological products. Its unique amino acid sequence and properties could be harnessed to improve the performance or functionality of these products in various industrial processes or applications.
Check Digit Verification of cas no
The CAS Registry Mumber 98815-38-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,8,1 and 5 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 98815-38:
(7*9)+(6*8)+(5*8)+(4*1)+(3*5)+(2*3)+(1*8)=184
184 % 10 = 4
So 98815-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C33H40N6O7/c1-19(36-32(45)26(34)16-22-8-12-24(40)13-9-22)31(44)39-28(18-21-6-4-3-5-7-21)33(46)37-20(2)30(43)38-27(29(35)42)17-23-10-14-25(41)15-11-23/h3-15,19-20,26-28,40-41H,16-18,34H2,1-2H3,(H2,35,42)(H,36,45)(H,37,46)(H,38,43)(H,39,44)/t19-,20-,26+,27+,28+/m1/s1