172152-36-2 Usage
Description
2-[(4-methoxy-3-methyl-pyridin-2-yl)methylsulfinyl]-5-pyrrol-1-yl-3H-benzoimidazole is a complex organic compound with a unique chemical structure that features a benzoimidazole core, a pyrrol-1-yl group, and a methylsulfinyl-substituted pyridin-2-yl group. This molecule exhibits a range of biological activities and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2-[(4-methoxy-3-methyl-pyridin-2-yl)methylsulfinyl]-5-pyrrol-1-yl-3H-benzoimidazole is used as a therapeutic agent for the treatment of various diseases. Its specific application reason is due to its ability to modulate biological targets, such as receptors, enzymes, or ion channels, which are involved in the pathogenesis of these diseases.
Used in Chemical Research:
In the field of chemical research, 2-[(4-methoxy-3-methyl-pyridin-2-yl)methylsulfinyl]-5-pyrrol-1-yl-3H-benzoimidazole serves as a valuable compound for studying its chemical properties, reactivity, and potential use as a building block for the synthesis of more complex molecules with diverse applications.
Used in Drug Delivery Systems:
Similar to gallotannin, 2-[(4-methoxy-3-methyl-pyridin-2-yl)methylsulfinyl]-5-pyrrol-1-yl-3H-benzoimidazole can be employed in drug delivery systems to enhance its bioavailability, delivery, and therapeutic outcomes. Various organic and metallic nanoparticles can be used as carriers for this compound, aiming to improve its overall efficacy in treating specific conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 172152-36-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,2,1,5 and 2 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 172152-36:
(8*1)+(7*7)+(6*2)+(5*1)+(4*5)+(3*2)+(2*3)+(1*6)=112
112 % 10 = 2
So 172152-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C19H18N4O2S/c1-13-17(20-8-7-18(13)25-2)12-26(24)19-21-15-6-5-14(11-16(15)22-19)23-9-3-4-10-23/h3-11H,12H2,1-2H3,(H,21,22)