175277-99-3 Usage
Description
2-Chloro-4-fluorothiophenol is an organic compound characterized by the presence of a thiophene ring with a chlorine atom at the 2nd position and a fluorine atom at the 4th position. It is known for its unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2-Chloro-4-fluorothiophenol is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with specific targeting and therapeutic properties.
Used in Chemical Research:
2-Chloro-4-fluorothiophenol is employed in the systematic investigation of halogen bonding in cathepsin L-inhibitor interactions. This application helps researchers understand the molecular interactions and develop more effective inhibitors for targeted therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 175277-99-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175277-99:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*9)+(1*9)=173
173 % 10 = 3
So 175277-99-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClFS/c7-5-3-4(8)1-2-6(5)9/h1-3,9H/p-1