246029-02-7 Usage
Description
5-FLUORO-7-HYDROXYBENZOFURAN is a chemical compound with the molecular formula C8H5FO2. It is a derivative of benzofuran, which is a heterocyclic compound containing a fused benzene and furan ring. 5-FLUORO-7-HYDROXYBENZOFURAN is a fluorinated benzofuran with a hydroxyl group attached to the seventh carbon atom. It is characterized by the presence of a fluorine atom and hydroxyl group, which provide it with unique properties and potential applications in various fields.
Uses
Used in Organic Chemistry:
5-FLUORO-7-HYDROXYBENZOFURAN is used as a building block in the synthesis of various pharmaceuticals and agrochemicals. Its unique structural features make it a valuable component in the development of new compounds with potential therapeutic and pesticidal properties.
Used in Drug Discovery and Development:
Due to its structural features, 5-FLUORO-7-HYDROXYBENZOFURAN may have potential biological activities and can be used in drug discovery and development. Researchers can explore its potential as a precursor for the creation of new drugs with improved efficacy and selectivity.
Used in the Pharmaceutical Industry:
5-FLUORO-7-HYDROXYBENZOFURAN is used as a key intermediate in the synthesis of pharmaceutical compounds. Its unique properties allow for the development of new drugs with novel mechanisms of action and potential therapeutic benefits.
Used in the Agrochemical Industry:
5-FLUORO-7-HYDROXYBENZOFURAN is also used as a building block in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique structural features can contribute to the development of more effective and environmentally friendly agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 246029-02-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,6,0,2 and 9 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 246029-02:
(8*2)+(7*4)+(6*6)+(5*0)+(4*2)+(3*9)+(2*0)+(1*2)=117
117 % 10 = 7
So 246029-02-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H5FO2/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,10H
246029-02-7Relevant articles and documents
1,3 DI-SUBSTITUTED CYCLOBUTANE OR AZETIDINE DERIVATIVES AS HEMATOPOIETIC PROSTAGLANDIN D SYNTHASE INHIBITORS
-
, (2018/04/27)
A compound of formula (I), wherein R, R1, R2, R3, Y, Y1, a, X, and Z are as defined herein. The compounds of the present invention are inhibitors of hematopoietic prostaglandin D synthase (H-PGDS) and can be useful in the treatment of Duchenne Muscular Dystrophy. Accordingly, the invention is further directed to pharmaceutical compositions comprising a compound of the invention. The invention is still further directed to methods of inhibiting H-PGDS activity and treatment of disorders associated therewith using a compound of the invention or a pharmaceutical composition comprising a compound of the invention.
