288401-64-9 Usage
Description
4-Fluoro-2-(1H-pyrazol-3-yl)phenol is a halo-substituted phenolic pyrazole derivative, characterized by the presence of a fluorine atom and a pyrazole ring attached to a phenol structure. This unique molecular composition endows it with potential applications in various fields due to its chemical properties and reactivity.
Usage:
Used in Pharmaceutical Industry:
4-Fluoro-2-(1H-pyrazol-3-yl)phenol is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological receptors or enzymes.
Used in Chemical Research:
In the field of chemical research, 4-Fluoro-2-(1H-pyrazol-3-yl)phenol serves as a valuable compound for studying the properties and reactivity of halo-substituted phenolic pyrazole derivatives. This can lead to a better understanding of their potential applications and the development of new synthetic methods.
Used in Material Science:
4-Fluoro-2-(1H-pyrazol-3-yl)phenol can be utilized as a building block for the development of novel materials with specific properties, such as improved stability, reactivity, or selectivity. Its unique structure may contribute to the creation of advanced materials for various applications, including sensors, catalysts, or coatings.
Used in Agrochemical Industry:
4-Fluoro-2-(1H-pyrazol-3-yl)phenol may also find applications in the agrochemical industry as a starting material for the synthesis of new pesticides or herbicides. Its chemical properties could be exploited to develop more effective and environmentally friendly products for agricultural use.
Check Digit Verification of cas no
The CAS Registry Mumber 288401-64-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,8,4,0 and 1 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 288401-64:
(8*2)+(7*8)+(6*8)+(5*4)+(4*0)+(3*1)+(2*6)+(1*4)=159
159 % 10 = 9
So 288401-64-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H7FN2O/c10-6-1-2-9(13)7(5-6)8-3-4-11-12-8/h1-5,11-12H/b8-7-