31075-53-3 Usage
Description
2,3,5-Triiodobenzyl alcohol, also known as (2,3,5-triiodophenyl)methanol [IUPAC name], is an organic compound characterized by the presence of three iodine atoms attached to the benzyl alcohol structure. This unique molecular configuration endows it with specific properties that make it suitable for various applications across different industries.
Uses
Used in Pharmaceutical Industry:
2,3,5-Triiodobenzyl alcohol is used as an intermediate compound for the synthesis of pharmaceutical products. Its unique structure allows it to be a key component in the development of drugs targeting various medical conditions.
Used in Chemical Synthesis:
In the field of organic chemistry, 2,3,5-Triiodobenzyl alcohol is used as a building block for the creation of more complex molecules. Its iodine atoms can participate in various chemical reactions, making it a versatile starting material for the synthesis of novel compounds.
Used in Analytical Chemistry:
Due to its distinct chemical properties, 2,3,5-Triiodobenzyl alcohol can be employed as a reagent or a reference compound in analytical chemistry. It may be used to calibrate instruments, validate analytical methods, or as a standard in comparative studies.
Used in Research and Development:
The unique structure and properties of 2,3,5-Triiodobenzyl alcohol make it an interesting subject for research and development. It can be utilized in the exploration of new chemical reactions, the development of innovative materials, or the study of biological interactions at the molecular level.
Used in Radiopharmaceuticals:
Given its high iodine content, 2,3,5-Triiodobenzyl alcohol can be used in the development of radiopharmaceuticals, particularly those involving iodine-123 or iodine-131 as radiotracers. These radiopharmaceuticals can be employed in medical imaging and targeted therapy for various diseases, including cancer.
Used in Material Science:
The properties of 2,3,5-Triiodobenzyl alcohol may also find applications in material science, where it could be used to develop new materials with specific characteristics, such as enhanced stability, improved thermal or electrical conductivity, or unique optical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 31075-53-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,0,7 and 5 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 31075-53:
(7*3)+(6*1)+(5*0)+(4*7)+(3*5)+(2*5)+(1*3)=83
83 % 10 = 3
So 31075-53-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H5I3O/c8-5-1-4(3-11)7(10)6(9)2-5/h1-2,11H,3H2
31075-53-3Relevant articles and documents
Radiopaque polyvinyl alcohol microsphere
-
Paragraph 0032-0034, (2019/11/12)
The invention relates to a radiopaque polyvinyl alcohol microsphere and a preparation method thereof, wherein the radiopaque polyvinyl alcohol microsphere comprises a polyvinyl alcohol hydrogel bead,2, 3, 5-triiodobenzaldehyde and organic acids. The radio