61-71-2 Usage
Description
3-IODOPHENYL ACETATE is an organic compound that serves as a valuable reagent in chemical synthesis and research. It is characterized by its unique structure, which includes an iodine atom attached to a phenyl group and an acetate group. This structure endows 3-IODOPHENYL ACETATE with specific chemical properties that make it suitable for various applications.
Uses
Used in Chemical Synthesis:
3-IODOPHENYL ACETATE is used as a reagent for the diastereoselective preparation of spiro[furo[3,4-c]chromene-1,3''-indoline]triones. Its unique structure allows it to participate in specific chemical reactions, leading to the formation of desired products with high selectivity.
In the pharmaceutical industry, 3-IODOPHENYL ACETATE may be used as a building block or intermediate in the synthesis of complex organic molecules, including potential drug candidates. Its ability to participate in various types of chemical reactions makes it a versatile tool for medicinal chemists.
Additionally, 3-IODOPHENYL ACETATE could be employed in the development of new materials, such as polymers or other organic compounds, where its unique structure and reactivity contribute to the desired properties of the final product.
Check Digit Verification of cas no
The CAS Registry Mumber 61-71-2 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 6 and 1 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 61-71:
(4*6)+(3*1)+(2*7)+(1*1)=42
42 % 10 = 2
So 61-71-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H7NO2/c10-7-5-3-1-2-4-6(5)9-8(7)11/h1-4,7,10H,(H,9,11)
61-71-2Relevant articles and documents
3-Hydroxy-3-((3-methyl-4-nitroisoxazol-5-yl)methyl)indolin-2-one as a versatile intermediate for retro-Henry and Friedel-Crafts alkylation reactions in aqueous medium
Nagaraju, Sakkani,Sathish, Kota,Paplal, Banoth,Satyanarayana, Neeli,Kashinath, Dhurke
, p. 14045 - 14050 (2019/09/18)
The first example of a retro-Henry type reaction is reported using 3-hydroxy-3-((3-methyl-4-nitroisoxazol-5-yl)methyl)indolin-2-ones which are prepared via catalyst-free Henry reaction of 3,5-dimethyl-4-nitroisoxazole and isatin. These compounds were used
Reductive coupling of isatins with ketones and aldehydes by low-valent titanium
Kise, Naoki,Sasaki, Kouta,Sakurai, Toshihiko
, p. 9668 - 9675 (2015/01/08)
The reductive coupling of isatins with ketones and aldehydes by Zn-TiCl4 in THF gave two- and four-electron reduced products, 3-hydoxy-3-(1-hydoxyalkyl)oxindoles and 3-alkylideneoxindoles, selectively by controlling the reaction conditions. Alt
