72338-49-9 Usage
Description
17-Bromoheptadecanoic acid-methyl ester is a chemical compound with a 17-carbon chain, featuring a bromine atom attached at the seventh carbon and a methyl group esterified to the carboxylic acid functional group. This fatty acid derivative possesses unique chemical and physical properties due to the presence of the bromine atom, making it a versatile molecule for various industrial and chemical applications.
Uses
Used in Surfactant and Emulsifier Production:
17-Bromoheptadecanoic acid-methyl ester is used as a component in the production of surfactants and emulsifiers, where its unique properties contribute to the stability and effectiveness of these products.
Used in Lubricant Formulation:
17-BROMOHEPTADECANOIC ACID-METHYL ESTER is also utilized in the formulation of lubricants, enhancing their performance and providing specific characteristics required for various applications.
Used in Specialty Chemicals:
17-Bromoheptadecanoic acid-methyl ester finds use in the development of specialty chemicals, where its unique properties can be tailored to meet specific industry needs.
Used as a Building Block in Organic Synthesis:
Furthermore, this versatile chemical serves as a building block in the synthesis of other organic compounds, expanding its potential applications in research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 72338-49-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,3,3 and 8 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 72338-49:
(7*7)+(6*2)+(5*3)+(4*3)+(3*8)+(2*4)+(1*9)=129
129 % 10 = 9
So 72338-49-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H35BrO2/c1-21-18(20)16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19/h2-17H2,1H3
