99010-09-0 Usage
Description
N4-(2-METHYLPROPYL)-3,4-QUINOLINEDIAMINE, also known as 4-Isobutylamino-3-aminoquinoline, is a pharmacologically active compound closely related to Imiquimod (I475000), an immune response modifier. It possesses the ability to stimulate the production of Interferon-a, which plays a crucial role in the immune system's response to various stimuli.
Uses
Used in Pharmaceutical Industry:
N4-(2-METHYLPROPYL)-3,4-QUINOLINEDIAMINE is used as an immune response modifier for its ability to stimulate the production of Interferon-a. This makes it a valuable compound in the development of treatments for various conditions that require modulation of the immune system, such as infections, inflammatory diseases, and certain types of cancer.
Used in Antiviral Applications:
In the pharmaceutical industry, N4-(2-METHYLPROPYL)-3,4-QUINOLINEDIAMINE is used as an antiviral agent due to its ability to enhance the immune system's response to viral infections. By stimulating the production of Interferon-a, it helps the body to fight off viral pathogens more effectively.
Used in Anti-inflammatory Applications:
N4-(2-METHYLPROPYL)-3,4-QUINOLINEDIAMINE is also used as an anti-inflammatory agent, as its immune-modulating properties can help to reduce inflammation in the body. This makes it a potential candidate for the treatment of various inflammatory conditions, such as arthritis and autoimmune diseases.
Used in Cancer Treatment:
In the field of oncology, N4-(2-METHYLPROPYL)-3,4-QUINOLINEDIAMINE is used as a potential therapeutic agent for cancer treatment. Its ability to stimulate the production of Interferon-a can help to boost the immune system's response to cancer cells, potentially leading to the inhibition of tumor growth and metastasis.
Check Digit Verification of cas no
The CAS Registry Mumber 99010-09-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,0,1 and 0 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 99010-09:
(7*9)+(6*9)+(5*0)+(4*1)+(3*0)+(2*0)+(1*9)=130
130 % 10 = 0
So 99010-09-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H17N3/c1-9(2)7-16-13-10-5-3-4-6-12(10)15-8-11(13)14/h3-6,8-9H,7,14H2,1-2H3,(H,15,16)