This chemical is called [1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde, and it can also be named as 4-hydro-1,2,4-triazolo[1,5-a]pyridine-6-carbaldehyde. With the molecular formula of C₇H₅N₃O, its molecular weight is 147.1341. The CAS registry number of this chemical is 614750-81-1. Additionally, its product categories are Pharmaceutical Intermediates; Aldehyde.

Other characteristics of the [1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde can be summarised as followings:(1)# of Rule of 5 Violations: 0; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 6.028; (5)ACD/KOC (pH 7.4): 6.029; (6)#H bond acceptors: 4; (7)#H bond donors: 0; (8)#Freely Rotating Bonds: 1; (9)Polar Surface Area: 47.26 Ų; (10)Index of Refraction: 1.696; (11)Molar Refractivity: 40.62 cm³; (12)Molar Volume: 105.588 cm³; (13)Polarizability: 16.103×10^-24cm³; (14)Surface Tension: 60.378 dyne/cm; (15)Density: 1.393 g/cm³.

You can still convert the following datas into molecular structure:
1.SMILES: c1cc2ncnn2cc1C=O
2.InChI: InChI=1/C7H5N3O/c11-4-6-1-2-7-8-5-9-10(7)3-6/h1-5H
3.InChIKey: SYLGZKAGHAOGFM-UHFFFAOYAL