The (1-Aminopentan-2-yl)(butyl)methylamine has the CAS registry number 94226-15-0. This chemical's molecular formula is C₁₀H₂₄N₂ and molecular weight is 172.31. What's more, its systematic name is 2-propylheptane-1,3-diamine.

Physical properties of (1-Aminopentan-2-yl)(butyl)methylamine are: (1)ACD/LogP: 1.93; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 4; (5)#Freely Rotating Bonds: 9; (6)Polar Surface Area: 6.48 Å²; (7)Index of Refraction: 1.461; (8)Molar Refractivity: 55.36 cm³; (9)Molar Volume: 201.7 cm³; (10)Polarizability: 21.94×10^-24cm³; (11)Surface Tension: 32.8 dyne/cm; (12)Density: 0.854 g/cm³; (13)Flash Point: 118.2 °C; (14)Enthalpy of Vaporization: 47.95 kJ/mol; (15)Boiling Point: 242.5 °C at 760 mmHg; (16)Vapour Pressure: 0.0338 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: NCC(C(N)CCCC)CCC
(2)InChI: InChI=1S/C10H24N2/c1-3-5-7-10(12)9(8-11)6-4-2/h9-10H,3-8,11-12H2,1-2H3
(3)InChIKey: FFVYQWXBWCSHEI-UHFFFAOYSA-N