The (Perfluoro-n-octyl)phenyliodonium, with the CAS registry number of 77758-89-5, is also known as Perfluorooctylphenyliodoniumtrifluoromethanesulfonate. It belongs to the product categories of Fits Reagents. This chemical's molecular formula is C₁₅H₅F₂₀IO₃S and molecular weight is 772.14. What's more, its IUPAC name is 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 8-Heptadecafluorooctyl(phenyl)iodanium and its systematic name is (Heptadecafluorooctyl)(phenyl)iodonium trifluoromethanesulfonate. In addition, it must be stored in refrigerator.

Uses of (Perfluoro-n-octyl)phenyliodonium: it is used to produce other chemicals. For example, it is used to produce trans-b-(Perflouroalkyl)styrene by heating. The reaction needs reagent pyridine and solvent CH₂Cl₂. The reaction time is 0.5 hours. The yield is about 73 %.

You can still convert the following datas into molecular structure:
(1) SMILES: FC(F)([I+]c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.FC(F)(F)S([O-])(=O)=O
(2) InChI: InChI=1/C14H5F17I.CHF3O3S/c15-7(16,9(19,20)11(23,24)13(27,28)29)8(17,18)10(21,22)12(25,26)14(30,31)32-6-4-2-1-3-5-6;2-1(3,4)8(5,6)7/h1-5H;(H,5,6,7)/q+1;/p-1
(3) InChIKey: LQSJCHNACSIGQK-REWHXWOFAH