The 1-(5,8-Dimethoxy-3,4-dihydronaphthalen-2-yl)ethanone, with the CAS registry number 75251-98-8, is also known as 5,8-Dimethoxy-2-acetyl-3,4-dihydronaphthalene. This chemical's molecular formula is C₁₄H₁₆O₃ and molecular weight is 232.27504. Its IUPAC name is called 1-(5,8-dimethoxy-3,4-dihydronaphthalen-2-yl)ethanone.

Physical properties of 1-(5,8-Dimethoxy-3,4-dihydronaphthalen-2-yl)ethanone: (1)ACD/LogP: 3.02; (2)ACD/LogD (pH 5.5): 3; (3)ACD/LogD (pH 7.4): 3; (4)ACD/BCF (pH 5.5): 132; (5)ACD/BCF (pH 7.4): 132; (6)ACD/KOC (pH 5.5): 1145; (7)ACD/KOC (pH 7.4): 1145; (8)#H bond acceptors: 3; (9)#Freely Rotating Bonds: 3; (10)Index of Refraction: 1.543; (11)Molar Refractivity: 65.201 cm³; (12)Molar Volume: 206.803 cm³; (13)Surface Tension: 39.671 dyne/cm; (14)Density: 1.123 g/cm³; (15)Flash Point: 194.515 °C; (16)Enthalpy of Vaporization: 66.429 kJ/mol; (17)Boiling Point: 411.766 °C at 760 mmHg; (18)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC(=O)C1=CC2=C(C=CC(=C2CC1)OC)OC
(2)InChI: InChI=1S/C14H16O3/c1-9(15)10-4-5-11-12(8-10)14(17-3)7-6-13(11)16-2/h6-8H,4-5H2,1-3H3
(3)InChIKey: YNXGVXBSQAEVTO-UHFFFAOYSA-N