The 1,2-Benzenediol, ethyl-, with the CAS registry number 28930-20-3, is also known as 3-Ethyl-pyrocatechol. Its EINECS registry number is 249-318-3. This chemical's molecular formula is C₈H₁₀O₂ and molecular weight is 138.1638. Its IUPAC name is called 3-ethylbenzene-1,2-diol.

Physical properties of 1,2-Benzenediol, ethyl-: (1)ACD/LogP: 1.87; (2)ACD/LogD (pH 5.5): 1.87; (3)ACD/LogD (pH 7.4): 1.87; (4)ACD/BCF (pH 5.5): 15.57; (5)ACD/BCF (pH 7.4): 15.49; (6)ACD/KOC (pH 5.5): 248.33; (7)ACD/KOC (pH 7.4): 247.07; (8)#H bond acceptors: 2; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.578; (12)Molar Refractivity: 39.56 cm³; (13)Molar Volume: 119.1 cm³; (14)Surface Tension: 48.2 dyne/cm; (15)Density: 1.159 g/cm³; (16)Flash Point: 123.9 °C; (17)Enthalpy of Vaporization: 51.48 kJ/mol; (18)Boiling Point: 257.2 °C at 760 mmHg; (19)Vapour Pressure: 0.00914 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCC1=C(C(=CC=C1)O)O
(2)InChI: InChI=1S/C8H10O2/c1-2-6-4-3-5-7(9)8(6)10/h3-5,9-10H,2H2,1H3
(3)InChIKey: UUCQGNWZASKXNN-UHFFFAOYSA-N