The 1,3,5-Triazine-2,4,6-triamine,compounds,sulfate, with the CAS registry number 84962-53-8, is also known as Melamine sulfate. Its EINECS number is 284-751-1. This chemical's molecular formula is C₃H₈N₆O₄S and molecular weight is 224.20. What's more, its systematic name is 1,3,5-Triazine-2,4,6-triamine sulfate.

Physical properties of 1,3,5-Triazine-2,4,6-triamine,compounds,sulfate are: (1)ACD/LogP: -1.37; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): -1.76; (4)ACD/LogD (pH 7.4): -1.38; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1.75; (8)ACD/KOC (pH 7.4): 4.21; (9)#H bond acceptors: 6; (10)#H bond donors: 6; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 48.39 Å²; (13)Flash Point: 325.3 °C; (14)Enthalpy of Vaporization: 83.94 kJ/mol; (15)Boiling Point: 557.5 °C at 760 mmHg; (16)Vapour Pressure: 1.82E-12 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=S(=O)(O)O.n1c(nc(nc1N)N)N
(2)InChI: InChI=1S/C3H6N6.H2O4S/c4-1-7-2(5)9-3(6)8-1;1-5(2,3)4/h(H6,4,5,6,7,8,9);(H2,1,2,3,4)
(3)InChIKey: LTURHSAEWJPFAA-UHFFFAOYSA-N