The 1-Phenyl-2-N-pyrrolidinopentane hydrochloride, with the CAS registry number 493-92-5, is also known as 1-[1-(Phenylmethyl)butyl]pyrrolidine. Its EINECS registry number is 207-784-5. This chemical's molecular formula is C₁₅H₂₃N and molecular weight is 217.3498. What's more, both its IUPAC name and systematic name are the same which is called 1-(1-Phenylpentan-2-yl)pyrrolidine.

Physical properties about 1-Phenyl-2-N-pyrrolidinopentane hydrochloride are: (1)ACD/LogP: 4.12; (2)#of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.02; (4)ACD/LogD (pH 7.4): 1.26; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1.11; (7)ACD/KOC (pH 5.5): 3.33; (8)ACD/KOC (pH 7.4): 5.78; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 3.24 Å²; (13)Index of Refraction: 1.529; (14)Molar Refractivity: 69.63 cm³; (15)Molar Volume: 225.6 cm³; (16)Polarizability: 27.6×10^-24 cm³; (17)Surface Tension: 37.7 dyne/cm; (18)Density: 0.963 g/cm³; (19)Flash Point: 123.3 °C; (20)Enthalpy of Vaporization: 53.99 kJ/mol; (21)Boiling Point: 299.9 °C at 760 mmHg; (22)Vapour Pressure: 0.00116 mmHg at 25 °C.

Uses of 1-Phenyl-2-N-pyrrolidinopentane hydrochloride: it is used to produce 1-(1-Benzyl-butyl)-pyrrolidin-2-one. The reaction occurs with reagents KMnO₄, 18-crown-6 and solvent CH₂Cl₂ The reaction time is 1 hour. The yield is 90%.

You can still convert the following datas into molecular structure:
(1) SMILES: c1ccccc1CC(N2CCCC2)CCC
(2) InChI: InChI=1/C15H23N/c1-2-8-15(16-11-6-7-12-16)13-14-9-4-3-5-10-14/h3-5,9-10,15H,2,6-8,11-13H2,1H3
(3) InChIKey: OJCPSBCUMRIPFL-UHFFFAOYAY

The toxicity data is as follows: