The 1-Propanamine,3-[2-(chloromethyl)phenoxy]-N,N-dimethyl-, hydrochloride (1:1), with the CAS registry number 930111-03-8, is also known as 2-[3-(Dimethylamino)propoxy]benzyl chloride hydrochloride 97%. This chemical's molecular formula is C₁₂H₁₉Cl₂NO and molecular weight is 264.1914. Its systematic name is called 3-[2-(chloromethyl)phenoxy]-N,N-dimethyl-propan-1-amine hydrochloride.

Physical properties of 1-Propanamine,3-[2-(chloromethyl)phenoxy]-N,N-dimethyl-, hydrochloride (1:1): (1)ACD/LogP: 2.33; (2)ACD/LogD (pH 7.4): 0.42; (3)#H bond acceptors: 2; (4)#Freely Rotating Bonds: 6; (5)Flash Point: 164.9 °C; (6)Enthalpy of Vaporization: 60.52 kJ/mol; (7)Boiling Point: 349 °C at 760 mmHg; (8)Vapour Pressure: 3.41E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: CN(C)CCCOc1ccccc1CCl.Cl
(2)InChI: InChI=1/C12H18ClNO.ClH/c1-14(2)8-5-9-15-12-7-4-3-6-11(12)10-13;/h3-4,6-7H,5,8-10H2,1-2H3;1H
(3)InChIKey: FJINIPMBLHIDJV-UHFFFAOYAZ