The 1H-Inden-1-one,4-bromo-2,3-dihydro-2-methyl-, with the CAS registry number 174702-59-1, is also known as 4-Bromo-2-methylindan-1-one. This chemical's molecular formula is C₁₀H₉BrO and molecular weight is 225.0819. Its systematic name is called 4-bromo-2-methyl-2,3-dihydro-1H-inden-1-one.

Physical properties of 1H-Inden-1-one,4-bromo-2,3-dihydro-2-methyl-: (1)ACD/LogP: 2.71; (2)ACD/LogD (pH 5.5): 4; (3)ACD/LogD (pH 7.4): 4; (4)ACD/BCF (pH 5.5): 271; (5)ACD/BCF (pH 7.4): 271; (6)ACD/KOC (pH 5.5): 1917; (7)ACD/KOC (pH 7.4): 1917; (8)#H bond acceptors: 1; (9)Index of Refraction: 1.589; (10)Molar Refractivity: 50.956 cm³; (11)Molar Volume: 151.198 cm³; (12)Surface Tension: 42.82 dyne/cm; (13)Density: 1.489 g/cm³; (14)Flash Point: 99.356 °C; (15)Enthalpy of Vaporization: 54.658 kJ/mol; (16)Boiling Point: 306.089 °C at 760 mmHg; (17)Vapour Pressure: 0.001 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Brc1cccc2c1CC(C2=O)C
(2)InChI: InChI=1/C10H9BrO/c1-6-5-8-7(10(6)12)3-2-4-9(8)11/h2-4,6H,5H2,1H3
(3)InChIKey: AHMJTIYXKJRVFF-UHFFFAOYAO