The 1H-Indene,4-chloro-2-methyl-, with the CAS registry number 210628-07-2, is also known as 7-Chloro-2-methylindene. This chemical's molecular formula is C₁₀H₉Cl and molecular weight is 164.63. Its systematic name is called 4-chloro-2-methyl-1H-indene.

Physical properties of 1H-Indene,4-chloro-2-methyl-: (1)ACD/LogP: 3.88; (2)ACD/LogD (pH 5.5): 3.88; (3)ACD/LogD (pH 7.4): 3.88; (4)ACD/BCF (pH 5.5): 519.31; (5)ACD/BCF (pH 7.4): 519.31; (6)ACD/KOC (pH 5.5): 3057.06; (7)ACD/KOC (pH 7.4): 3057.06; (8)Index of Refraction: 1.586; (9)Molar Refractivity: 47.62 cm³; (10)Molar Volume: 141.7 cm³; (11)Surface Tension: 38.7 dyne/cm; (12)Density: 1.161 g/cm³; (13)Flash Point: 85.5 °C; (14)Enthalpy of Vaporization: 46.73 kJ/mol; (15)Boiling Point: 249.8 °C at 760 mmHg; (16)Vapour Pressure: 0.0355 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc2cccc1CC(/C)=C\c12
(2)InChI: InChI=1/C10H9Cl/c1-7-5-8-3-2-4-10(11)9(8)6-7/h2-4,6H,5H2,1H3
(3)InChIKey: QWJRBTRSAZACSX-UHFFFAOYAM