The 1H-Indol-6-amine, 2,3-dihydro-3,3-dimethyl-, with the CAS registry number 179898-73-8, is also known as ZINC31777118. This chemical's molecular formula is C₁₀H₁₄N₂ and molecular weight is 162.23156. Its IUPAC name is called 3,3-dimethyl-1,2-dihydroindol-6-amine.

Physical properties of 1H-Indol-6-amine, 2,3-dihydro-3,3-dimethyl-: (1)ACD/LogP: 0.82; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 7; (5)ACD/KOC (pH 7.4): 32; (6)#H bond acceptors: 2; (7)#H bond donors: 3; (8)#Freely Rotating Bonds: 1; (9)Index of Refraction: 1.567; (10)Molar Refractivity: 50.721 cm³; (11)Molar Volume: 155.252 cm³; (12)Surface Tension: 41.967 dyne/cm; (13)Density: 1.045 g/cm³; (14)Flash Point: 154.421 °C; (15)Enthalpy of Vaporization: 53.557 kJ/mol; (16)Boiling Point: 295.831 °C at 760 mmHg; (17)Vapour Pressure: 0.001 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC1(CNC2=C1C=CC(=C2)N)C
(2)InChI: InChI=1S/C10H14N2/c1-10(2)6-12-9-5-7(11)3-4-8(9)10/h3-5,12H,6,11H2,1-2H3
(3)InChIKey: OVSRQUPJJIAWID-UHFFFAOYSA-N