The 1H-Indole, 5-methoxy-2,3-dimethyl-, with the CAS registry number 828-94-4, is also known as 2,3-Dimethyl-1H-indol-5-yl methyl ether. This chemical's molecular formula is C₁₁H₁₃NO and molecular weight is 175.227. Its systematic name is called 5-methoxy-2,3-dimethyl-1H-indole.

Physical properties of 1H-Indole, 5-methoxy-2,3-dimethyl-: (1)ACD/LogP: 2.98; (2)#H bond acceptors: 2; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 1; (5)Index of Refraction: 1.609; (6)Molar Refractivity: 54.85 cm³; (7)Molar Volume: 158.4 cm³; (8)Surface Tension: 41.7 dyne/cm; (9)Density: 1.106 g/cm³; (10)Flash Point: 119.2 °C; (11)Enthalpy of Vaporization: 54.49 kJ/mol; (12)Boiling Point: 325.3 °C at 760 mmHg; (13)Vapour Pressure: 0.00044 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O(c1cc2c(cc1)nc(c2C)C)C
(2)InChI: InChI=1/C11H13NO/c1-7-8(2)12-11-5-4-9(13-3)6-10(7)11/h4-6,12H,1-3H3
(3)InChIKey: GZSTUEGIANKNTE-UHFFFAOYAQ