The 2-(1,3-Thiazol-4-yl)acetamide, with the CAS registry number 51551-54-3, is also known as 4-Thiazoleacetamide. This chemical's molecular formula is C₅H₆N₂OS and molecular weight is 142.18. What's more, its systematic name is 2-(1,3-thiazol-4-yl)acetamide.

Physical properties of 2-(1,3-Thiazol-4-yl)acetamide are: (1)ACD/LogP: -1.33; (2)# of Rule of 5 Violations: 0 ; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 4.5; (6)ACD/KOC (pH 7.4): 4.51; (7)#H bond acceptors: 3; (8)#H bond donors: 2; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 61.44 Å²; (11)Index of Refraction: 1.593; (12)Molar Refractivity: 35.84 cm³; (13)Molar Volume: 105.7 cm³; (14)Polarizability: 14.2×10^-24 cm³; (15)Surface Tension: 60.7 dyne/cm; (16)Density: 1.344 g/cm³; (17)Flash Point: 182.2 °C; (18)Enthalpy of Vaporization: 62.55 kJ/mol; (19)Boiling Point: 377.7 °C at 760 mmHg; (20)Vapour Pressure: 6.63E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: O=C(N)Cc1ncsc1
(2)InChI: InChI=1/C5H6N2OS/c6-5(8)1-4-2-9-3-7-4/h2-3H,1H2,(H2,6,8)
(3)InChIKey: JJSRACWXUSIJFT-UHFFFAOYAW