The Imidazo(1,2-a)pyridine, 2-(p-nitrophenyl)-, with the CAS registry number 3323-26-0, is also known as 2-(p-Nitrophenyl)imidazo(1,2-a)pyridine. It belongs to the product category of Fused Ring Systems. This chemical's molecular formula is C₁₃H₉N₃O₂ and molecular weight is 239.23. What's more, its systematic name is 2-(4-nitrophenyl)imidazo[1,2-a]pyridine. Its classification code is Drug/Therapeutic Agent. 

Physical properties of Imidazo(1,2-a)pyridine, 2-(p-nitrophenyl)- are: (1)ACD/LogP: 3.02; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 5; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 63.12 Å²; (7)Index of Refraction: 1.686; (8)Molar Refractivity: 67.47 cm³; (9)Molar Volume: 177.2 cm³; (10)Polarizability: 26.75×10^-24cm³; (11)Surface Tension: 59 dyne/cm; (12)Density: 1.34 g/cm³.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC2=NC(=CN2C=C1)C3=CC=C(C=C3)[N+](=O)[O-]
(2)InChI: InChI=1S/C13H9N3O2/c17-16(18)11-6-4-10(5-7-11)12-9-15-8-2-1-3-13(15)14-12/h1-9H
(3)InChIKey: SNBCSKCONKUZBA-UHFFFAOYSA-N

The toxicity data is as follows: