The CAS registry number of 2(1H)-Quinolinone,6-methoxy-1-methyl- is 5392-11-0. This chemical's molecular formula is C₁₁H₁₁NO₂ and molecular weight is 189.21054. What's more, both its IUPAC name and systematic name are the same which is called 6-Methoxy-1-methylquinolin-2(1H)-one.

Physical properties about 2(1H)-Quinolinone,6-methoxy-1-methyl- are: (1)ACD/LogP: 1.52; (2)#of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 29.54 Å²; (7)Index of Refraction: 1.573; (8)Molar Refractivity: 53.11 cm³; (9)Molar Volume: 161.1 cm³; (10)Surface Tension: 42 dyne/cm; (11)Density: 1.174 g/cm³; (12)Flash Point: 146.1 °C; (13)Enthalpy of Vaporization: 55.94 kJ/mol; (14)Boiling Point: 317.9 °C at 760 mmHg; (15)Vapour Pressure: 0.000374 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C2/C=C\c1c(ccc(OC)c1)N2C
(2) InChI: InChI=1/C11H11NO2/c1-12-10-5-4-9(14-2)7-8(10)3-6-11(12)13/h3-7H,1-2H3
(3) InChIKey: HVDUJPYLXACBMJ-UHFFFAOYAU