The 2,3,5-Pyridinetriamine, with the CAS registry number 320734-48-3, is also known as 2,3,5-Triaminopyridine. This chemical's molecular formula is C₅H₈N₄ and molecular weight is 124.14. Its systematic name is called pyridine-2,3,5-triamine.

Physical properties of 2,3,5-Pyridinetriamine: (1)ACD/LogP: -1.75; (2)# of Rule of 5 Violations: 1; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 4; (6)ACD/KOC (pH 7.4): 9; (7)#H bond acceptors: 4; (8)#H bond donors: 6; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.766; (11)Molar Refractivity: 37.053 cm³; (12)Molar Volume: 89.498 cm³; (13)Surface Tension: 94.337 dyne/cm; (14)Density: 1.387 g/cm³; (15)Flash Point: 251.835 °C; (16)Enthalpy of Vaporization: 70.026 kJ/mol; (17)Boiling Point: 442.735 °C at 760 mmHg; (18)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Nc1cnc(N)c(N)c1
(2)InChI: InChI=1/C5H8N4/c6-3-1-4(7)5(8)9-2-3/h1-2H,6-7H2,(H2,8,9)
(3)InChIKey: MZAKJBZFJUUHGA-UHFFFAOYAG