The 2,3-Dichloro-6-methoxypyridine has the CAS registry number 83732-68-7. Its EINECS number is 280-618-7. This chemical's molecular formula is C₆H₅Cl₂NO and molecular weight is 178.02. What's more, its systematic name is 2,3-dichloro-6-methoxypyridine. 

Physical properties of 2,3-Dichloro-6-methoxypyridine are: (1)ACD/LogP: 3.04; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.04; (4)ACD/LogD (pH 7.4): 3.04; (5)ACD/BCF (pH 5.5): 119.52; (6)ACD/BCF (pH 7.4): 119.52; (7)ACD/KOC (pH 5.5): 1068.2; (8)ACD/KOC (pH 7.4): 1068.2; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 22.12 Å²; (13)Index of Refraction: 1.537; (14)Molar Refractivity: 40.81 cm³; (15)Molar Volume: 130.5 cm³; (16)Polarizability: 16.17×10^-24cm³; (17)Surface Tension: 40.7 dyne/cm; (18)Density: 1.363 g/cm³; (19)Flash Point: 86 °C; (20)Enthalpy of Vaporization: 43.64 kJ/mol; (21)Boiling Point: 218.6 °C at 760 mmHg; (22)Vapour Pressure: 0.184 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC1=NC(=C(C=C1)Cl)Cl
(2)InChI: InChI=1S/C6H5Cl2NO/c1-10-5-3-2-4(7)6(8)9-5/h2-3H,1H3
(3)InChIKey: PCVPVMZNHMYIDP-UHFFFAOYSA-N