This product is an organic compound with the formula C₇H₁₀Cl₂N₂. The systematic name of this chemical is 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine dihydrochloride. With the CAS registry number 6000-50-6, it is also named as 1H-pyrrolo[3,4-c]pyridine, 2,3-dihydro-, hydrochloride (1:2). In addition, the molecular weight is 193.0737.

The other characteristics of 2,3-Dihydro-1H-Pyrrolo[3,4-C]Pyridine dihydrochloride can be summarized as: (1)# of Rule of 5 Violations: 0; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 11.33; (6)#H bond acceptors: 2; (7)#H bond donors: 1; (8)#Freely Rotating Bonds: 0; (9)Polar Surface Area: 24.92 Å²; (10)Flash Point: 126.9 °C; (11)Enthalpy of Vaporization: 53.59 kJ/mol; (12)Boiling Point: 286.3 °C at 760 mmHg; (13)Vapour Pressure: 0.00203 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:Cl.Cl.C1NCc2cnccc12
2. InChI:InChI=1/C7H8N2.2ClH/c1-2-8-4-7-5-9-3-6(1)7;;/h1-2,4,9H,3,5H2;2*1H
3. InChIKey:GXQCGPVEDZFCGW-UHFFFAOYAT
4. Std. InChI:InChI=1S/C7H8N2.2ClH/c1-2-8-4-7-5-9-3-6(1)7;;/h1-2,4,9H,3,5H2;2*1H
5. Std. InChIKey:GXQCGPVEDZFCGW-UHFFFAOYSA-N