The 2,3-Dihydro-2-oxo-1H-indole-4-acetic acid, with the CAS registry number 122570-32-5, is also known as (2-Oxo-2,3-dihydro-1H-indol-4-yl)acetic acid. This chemical's molecular formula is C₁₀H₉NO₃ and molecular weight is 191.18. What's more, its systematic name is 2-(2-oxoindolin-4-yl)acetic acid.

Physical properties of 2,3-Dihydro-2-oxo-1H-indole-4-acetic acid are: (1)ACD/LogP: 0.61; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 66.4 Å²; (7)Index of Refraction: 1.616; (8)Molar Refractivity: 48.4 cm³; (9)Molar Volume: 138.4 cm³; (10)Polarizability: 19.19×10^-24cm³; (11)Surface Tension: 60.5 dyne/cm; (12)Density: 1.38 g/cm³; (13)Flash Point: 224.5 °C; (14)Enthalpy of Vaporization: 74.4 kJ/mol; (15)Boiling Point: 447.6 °C at 760 mmHg; (16)Vapour Pressure: 8.52E-09 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cc(c2c(c1)NC(=O)C2)CC(=O)O
(2)Std. InChI: InChI=1S/C10H9NO3/c12-9-5-7-6(4-10(13)14)2-1-3-8(7)11-9/h1-3H,4-5H2,(H,11,12)(H,13,14)
(3)Std. InChIKey: QLRIVXOWYWNENI-UHFFFAOYSA-N