The 2,4(1H,3H)-Pyrimidinedione,6-amino-5-methyl-, with the CAS registry number 15828-63-4, is also known as 6-Aminothymine. It belongs to the product category of Pyrimidine. This chemical's molecular formula is C₅H₇N₃O₂ and molecular weight is 141.13. Its IUPAC name is called 6-amino-5-methyl-1H-pyrimidine-2,4-dione.

Physical properties of 2,4(1H,3H)-Pyrimidinedione,6-amino-5-methyl-: (1)ACD/LogP: -0.79; (2)ACD/LogD (pH 5.5): -0.79; (3)ACD/LogD (pH 7.4): -0.79; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 8.85; (7)ACD/KOC (pH 7.4): 8.83; (8)#H bond acceptors: 5; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.526; (12)Molar Refractivity: 33.26 cm³; (13)Molar Volume: 108.3 cm³; (14)Surface Tension: 42.9 dyne/cm; (15)Density: 1.302 g/cm³.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC1=C(NC(=O)NC1=O)N
(2)InChI: InChI=1S/C5H7N3O2/c1-2-3(6)7-5(10)8-4(2)9/h1H3,(H4,6,7,8,9,10)
(3)InChIKey: CUTGVWHMTHWOJP-UHFFFAOYSA-N