The Boronic acid, B-(2,6-dichloro-4-pyridinyl)-, with the CAS registry number 1072951-54-2, is also known as 2,6-Dichloropyridine-4-boronic acid. This chemical's molecular formula is C₅H₄BCl₂NO₂ and molecular weight is 191.81. What's more, its systematic name is (2,6-dichloropyridin-4-yl)boronic acid.

Physical properties of Boronic acid, B-(2,6-dichloro-4-pyridinyl)- are: (1)ACD/LogP: 1.37; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.109; (4)ACD/LogD (pH 7.4): ; (5)ACD/BCF (pH 5.5): 3.541; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 72.324; (8)ACD/KOC (pH 7.4): 1.97; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 53.35 Å²; (13)Index of Refraction: 1.58; (14)Molar Refractivity: 40.742 cm³; (15)Molar Volume: 122.377 cm³; (16)Polarizability: 16.151×10^-24cm³; (17)Surface Tension: 60.662 dyne/cm; (18)Density: 1.567 g/cm³; (19)Flash Point: 193.768 °C; (20)Enthalpy of Vaporization: 68.247 kJ/mol; (21)Boiling Point: 396.783 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: B(C1=CC(=NC(=C1)Cl)Cl)(O)O
(2)InChI: InChI=1S/C5H4BCl2NO2/c7-4-1-3(6(10)11)2-5(8)9-4/h1-2,10-11H
(3)InChIKey: JFUQZFQJFYZZGY-UHFFFAOYSA-N