The 2-Amino-5-bromothiazole HCl, with the CAS registry number 133692-18-9, is also known as 2-Thiazolamine, 5-bromo-, hydrochloride (1:1). This chemical's molecular formula is C₃H₄BrClN₂S and molecular weight is 215.49926. Its IUPAC name is called 5-bromo-1,3-thiazol-2-amine hydrochloride.

Physical properties of 2-Amino-5-bromothiazole HCl: (1)ACD/LogP: 1.15; (2)ACD/LogD (pH 5.5): 1; (3)ACD/LogD (pH 7.4): 1; (4)ACD/BCF (pH 5.5): 4; (5)ACD/BCF (pH 7.4): 4; (6)ACD/KOC (pH 5.5): 100; (7)ACD/KOC (pH 7.4): 101; (8)#H bond acceptors: 2; (9)#H bond donors: 2; (10)Flash Point: 142 °C; (11)Enthalpy of Vaporization: 56.31 kJ/mol; (12)Boiling Point: 311.2 °C at 760 mmHg; (13)Vapour Pressure: 0.000424 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=C(SC(=N1)N)Br.Cl
(2)InChI: InChI=1S/C3H3BrN2S.ClH/c4-2-1-6-3(5)7-2;/h1H,(H2,5,6);1H
(3)InChIKey: XFDCNXIWKCIBAE-UHFFFAOYSA-N