The 2-Amino-isonicotinic acid hydrazide, with the CAS registry number of 58481-01-9, is also known as Aminoisonicotinohydrazide. This chemical's molecular formula is C₆H₈N₄O and molecular weight is 152.15. What's more, its IUPAC name is 2-Aminopyridine-4-carbohydrazide.

Physical properties about 2-Amino-isonicotinic acid hydrazide are: (1)ACD/LogP: -0.90; (2)# of Rule of 5 Violations: 1; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 5.83; (6)ACD/KOC (pH 7.4): 7.68; (7)#H bond acceptors: 5; (8)#H bond donors: 5; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 39.68 Å²; (11)Index of Refraction: 1.651; (12)Molar Refractivity: 41.1 cm³; (13)Molar Volume: 112.4 cm³; (14)Surface Tension: 73.8 dyne/cm; (15)Density: 1.352 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C(c1ccnc(N)c1)NN
(2) InChI: InChI=1/C6H8N4O/c7-5-3-4(1-2-9-5)6(11)10-8/h1-3H,8H2,(H2,7,9)(H,10,11)
(3) InChIKey: JWUWTBDKCYJSLE-UHFFFAOYAN