The Pyridine,2-bromo-4-phenyl-, with the CAS registry number 54151-74-5, is also known as ZINC02559926. This chemical's molecular formula is C₁₁H₈BrN and molecular weight is 234.09. Its IUPAC name is called 2-bromo-4-phenylpyridine.

Physical properties of Pyridine,2-bromo-4-phenyl-: (1)ACD/LogP: 3.30; (2)ACD/LogD (pH 5.5): 3.3; (3)ACD/LogD (pH 7.4): 3.3; (4)ACD/BCF (pH 5.5): 190.1; (5)ACD/BCF (pH 7.4): 190.1; (6)ACD/KOC (pH 5.5): 1489; (7)ACD/KOC (pH 7.4): 1489.04; (8)#H bond acceptors: 1; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.606; (11)Molar Refractivity: 56.62 cm³; (12)Molar Volume: 164.1 cm³; (13)Surface Tension: 45 dyne/cm; (14)Density: 1.426 g/cm³; (15)Flash Point: 142.3 °C; (16)Enthalpy of Vaporization: 53.06 kJ/mol; (17)Boiling Point: 311.7 °C at 760 mmHg; (18)Vapour Pressure: 0.00102 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C(C=C1)C2=CC(=NC=C2)Br
(2)InChI: InChI=1S/C11H8BrN/c12-11-8-10(6-7-13-11)9-4-2-1-3-5-9/h1-8H
(3)InChIKey: KRIILKQTJUOQCJ-UHFFFAOYSA-N