The 2-Bromo-6-bromoquinoline, with the CAS registry number 77514-31-9, has the molecular formula C₉H₅Br₂N. Besides, its molecular weight is 286.9507. Its systematic name is called 2,6-dibromoquinoline.

Physical properties of 2-Bromo-6-bromoquinoline: (1)ACD/LogP: 3.67; (2)ACD/LogD (pH 5.5): 3.67; (3)ACD/LogD (pH 7.4): 3.67; (4)ACD/BCF (pH 5.5): 361.6; (5)ACD/BCF (pH 7.4): 361.6; (6)ACD/KOC (pH 5.5): 2359.28; (7)ACD/KOC (pH 7.4): 2359.29; (8)#H bond acceptors: 1; (9)Index of Refraction: 1.698; (10)Molar Refractivity: 57.56 cm³; (11)Molar Volume: 149.1 cm³; (12)Surface Tension: 55 dyne/cm; (13)Density: 1.923 g/cm³; (14)Flash Point: 165.1 °C; (15)Enthalpy of Vaporization: 57.04 kJ/mol; (16)Boiling Point: 349.4 °C at 760 mmHg; (17)Vapour Pressure: 9.51E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Brc1ccc2nc(Br)ccc2c1
(2)InChI: InChI=1/C9H5Br2N/c10-7-2-3-8-6(5-7)1-4-9(11)12-8/h1-5H
(3)InChIKey: OISLXVPFMYSILE-UHFFFAOYAX