The 2-Bromo-N-(2-methoxyphenyl)acetamide, with the CAS registry number 32428-69-6, is also known as Acetamide, 2-bromo-N-(2-methoxyphenyl)-. This chemical's molecular formula is C₉H₁₀BrNO₂ and molecular weight is 244.08. Its systematic name is called 2-bromo-N-(2-methoxyphenyl)acetamide.

Physical properties of 2-Bromo-N-(2-methoxyphenyl)acetamide: (1)ACD/LogP: 1.68; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.68; (4)ACD/LogD (pH 7.4): 1.68; (5)ACD/BCF (pH 5.5): 11.08; (6)ACD/BCF (pH 7.4): 11.08; (7)ACD/KOC (pH 5.5): 194.71; (8)ACD/KOC (pH 7.4): 194.72; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Index of Refraction: 1.604; (13)Molar Refractivity: 54.93 cm³; (14)Molar Volume: 159.7 cm³; (15)Surface Tension: 47.7 dyne/cm; (16)Density: 1.528 g/cm³; (17)Flash Point: 166.7 °C; (18)Enthalpy of Vaporization: 59.67 kJ/mol; (19)Boiling Point: 351.9 °C at 760 mmHg; (20)Vapour Pressure: 3.97E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: BrCC(=O)Nc1ccccc1OC
(2)InChI: InChI=1/C9H10BrNO2/c1-13-8-5-3-2-4-7(8)11-9(12)6-10/h2-5H,6H2,1H3,(H,11,12)
(3)InChIKey: DMOPLFALZWOOTI-UHFFFAOYAM