The 3-Pyridinecarboxaldehyde,2-ethoxy- with CAS registry number of 885278-07-9 is also known as 2-Ethoxynicotinaldehyde. The IUPAC name is 2-Ethoxypyridine-3-carbaldehyde. In addition, the formula is C₈H₉NO₂ and the molecular weight is 151.16. What's more, this chemical should be sealed in cool, dry place away from oxidants and air.

Physical properties about 3-Pyridinecarboxaldehyde,2-ethoxy- are: (1)ACD/LogP: 1.44; (2)ACD/LogD (pH 5.5): 1.44; (3)ACD/LogD (pH 7.4): 1.44; (4)#H bond acceptors: 3; (5)#Freely Rotating Bonds: 3; (6)Index of Refraction: 1.541; (7)Molar Refractivity: 42.4 cm³; (8)Molar Volume: 134.8 cm³; (9)Surface Tension: 41.8 dyne/cm; (10)Density: 1.121 g/cm³; (11)Flash Point: 105.5 °C; (12)Enthalpy of Vaporization: 48.81 kJ/mol; (13)Boiling Point: 250.8 °C at 760 mmHg; (14)Vapour Pressure: 0.0212 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. Canonical SMILES: CCOC1=C(C=CC=N1)C=O
2. InChI: InChI=1S/C8H9NO2/c1-2-11-8-7(6-10)4-3-5-9-8/h3-6H,2H2,1H3
3. InChIKey: WHEFRNNNELKVRQ-UHFFFAOYSA-N