This chemical is called 2-Furancarboxamide,N-phenyl-, and it can also be named as 2-Furanilide. Its molecular formula is C₁₁H₉NO₂. The CAS registry number of this chemical is 1929-89-1. Additionally, the systematic name of this chemical is N-phenylfuran-2-carboxamide. 

Other characteristics of the 2-Furancarboxamide,N-phenyl- can be summarised as follows: (1)ACD/LogP: 2.38; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.38; (4)ACD/LogD (pH 7.4): 2.38; (5)ACD/BCF (pH 5.5): 37.67; (6)ACD/BCF (pH 7.4): 37.67; (7)ACD/KOC (pH 5.5): 467.39; (8)ACD/KOC (pH 7.4): 467.39; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 33.45 Ų; (13)Index of Refraction: 1.62; (14)Molar Refractivity: 53.12 cm³; (15)Molar Volume: 151 cm³; (16)Polarizability: 21.06×10^-24 cm³; (17)Surface Tension: 49.5 dyne/cm; (18)Density: 1.238 g/cm³; (19)Flash Point: 85.6 °C; (20)Enthalpy of Vaporization: 45.43 kJ/mol; (21)Boiling Point: 217.9 °C at 760 mmHg; (22)Vapour Pressure: 0.129 mmHg at 25°C.

You can still convert the following datas into molecular structure:
1.SMILES: O=C(Nc1ccccc1)c2occc2
2.InChI: InChI=1/C11H9NO2/c13-11(10-7-4-8-14-10)12-9-5-2-1-3-6-9/h1-8H,(H,12,13)
3.InChIKey: XHVDWCKBZSFUDE-UHFFFAOYAB