The 2-Methyl-5-nonanol, with the CAS registry number 29843-62-7, is also known as CID141512. This chemical's molecular formula is C₁₀H₂₂O and molecular weight is 158.28108. Its IUPAC name is called 2-methylnonan-5-ol.

Physical properties of 2-Methyl-5-nonanol: (1)ACD/LogP: 3.70; (2)ACD/LogD (pH 5.5): 3.7; (3)ACD/LogD (pH 7.4): 3.7; (4)ACD/BCF (pH 5.5): 378.88; (5)ACD/BCF (pH 7.4): 378.88; (6)ACD/KOC (pH 5.5): 2439.47; (7)ACD/KOC (pH 7.4): 2439.47; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 7; (11)Index of Refraction: 1.432; (12)Molar Refractivity: 49.82 cm³; (13)Molar Volume: 191.8 cm³; (14)Surface Tension: 28 dyne/cm; (15)Density: 0.824 g/cm³; (16)Flash Point: 87.9 °C; (17)Enthalpy of Vaporization: 51.49 kJ/mol; (18)Boiling Point: 206.4 °C at 760 mmHg; (19)Vapour Pressure: 0.0561 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCCCC(CCC(C)C)O
(2)InChI: InChI=1S/C10H22O/c1-4-5-6-10(11)8-7-9(2)3/h9-11H,4-8H2,1-3H3
(3)InChIKey: RLQVUGAVOCBRNQ-UHFFFAOYSA-N