The 2-Phenylacetohydrazide, with the CAS registry number 5437-84-3, is also known as Benzeneacetic acid, hydrazide. This chemical's molecular formula is C₈H₁₀N₂O and molecular weight is 150.1778. Its IUPAC name is called 2-phenylacetohydrazide.

Physical properties of 2-Phenylacetohydrazide: (1)ACD/LogP: 0.14; (2)ACD/LogD (pH 5.5): 0.14; (3)ACD/LogD (pH 7.4): 0.14; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 28.24; (7)ACD/KOC (pH 7.4): 28.35; (8)#H bond acceptors: 3; (9)#H bond donors: 3; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.565; (12)Molar Refractivity: 42.96 cm³; (13)Molar Volume: 131.8 cm³; (14)Surface Tension: 47.3 dyne/cm; (15)Density: 1.138 g/cm³; (16)Flash Point: 174.5 °C; (17)Enthalpy of Vaporization: 61.11 kJ/mol; (18)Boiling Point: 364.9 °C at 760 mmHg; (19)Vapour Pressure: 1.63E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C(C=C1)CC(=O)NN
(2)InChI: InChI=1S/C8H10N2O/c9-10-8(11)6-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,11)
(3)InChIKey: FPTCVTJCJMVIDV-UHFFFAOYSA-N