The 2-Thiazolamine,5-hexyl-, with the CAS registry number 383131-91-7, is also known as 5-Hexylthiazol-2-amine. This chemical's molecular formula is C₉H₁₆N₂S and molecular weight is 184.30174. Its systematic name is called 5-hexyl-1,3-thiazol-2-amine.

Physical properties of 2-Thiazolamine,5-hexyl-: (1)ACD/LogP: 3.50; (2)ACD/LogD (pH 5.5): 2.67; (3)ACD/LogD (pH 7.4): 3.47; (4)ACD/BCF (pH 5.5): 39.73; (5)ACD/BCF (pH 7.4): 249.33; (6)ACD/KOC (pH 5.5): 282.38; (7)ACD/KOC (pH 7.4): 1771.97; (8)#H bond acceptors: 2; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 5; (11)Index of Refraction: 1.548; (12)Molar Refractivity: 55.04 cm³; (13)Molar Volume: 173.2 cm³; (14)Surface Tension: 43.9 dyne/cm; (15)Density: 1.063 g/cm³; (16)Flash Point: 136.1 °C; (17)Enthalpy of Vaporization: 54.16 kJ/mol; (18)Boiling Point: 301.5 °C at 760 mmHg; (19)Vapour Pressure: 0.00105 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: n1cc(sc1N)CCCCCC
(2)InChI: InChI=1/C9H16N2S/c1-2-3-4-5-6-8-7-11-9(10)12-8/h7H,2-6H2,1H3,(H2,10,11)
(3)InChIKey: ZDEVQPCYUARWNW-UHFFFAOYAX