The 2-Vinyl-4-picoline, with the CAS registry number 26010-60-6, is also known as 4-Methyl-2-vinylpyridine. This chemical's molecular formula is C₈H₉N and molecular weight is 119.16376. Its systematic name is called 2-ethenyl-4-methylpyridine.

Physical properties of 2-Vinyl-4-picoline: (1)ACD/LogP: 1.80; (2)ACD/LogD (pH 5.5): 1.43; (3)ACD/LogD (pH 7.4): 1.79; (4)ACD/BCF (pH 5.5): 5.92; (5)ACD/BCF (pH 7.4): 13.48; (6)ACD/KOC (pH 5.5): 97.88; (7)ACD/KOC (pH 7.4): 222.9; (8)#H bond acceptors: 1; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.555; (11)Molar Refractivity: 40.09 cm³; (12)Molar Volume: 124.8 cm³; (13)Surface Tension: 35.1 dyne/cm; (14)Density: 0.954 g/cm³; (15)Flash Point: 65.6 °C; (16)Enthalpy of Vaporization: 40.75 kJ/mol; (17)Boiling Point: 188.7 °C at 760 mmHg; (18)Vapour Pressure: 0.816 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: n1ccc(cc1\C=C)C
(2)InChI: InChI=1/C8H9N/c1-3-8-6-7(2)4-5-9-8/h3-6H,1H2,2H3
(3)InChIKey: WVNIWWGCVMYYJZ-UHFFFAOYAU