The 3-(Bromomethyl)phenol, with the CAS registry number 74597-04-9, has the molecular formula C₇H₇BrO. In addition, its molecular weight is 187.0339. Its systematic name is called 3-(bromomethyl)phenol.

Physical properties of 3-(Bromomethyl)phenol: (1)ACD/LogP: 2.23; (2)ACD/LogD (pH 5.5): 2; (3)ACD/LogD (pH 7.4): 2; (4)ACD/BCF (pH 5.5): 27; (5)ACD/BCF (pH 7.4): 27; (6)ACD/KOC (pH 5.5): 367; (7)ACD/KOC (pH 7.4): 364; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.612; (12)Molar Refractivity: 40.783 cm³; (13)Molar Volume: 117.356 cm³; (14)Surface Tension: 49.471 dyne/cm; (15)Density: 1.594 g/cm³; (16)Flash Point: 118.335 °C; (17)Enthalpy of Vaporization: 53.086 kJ/mol; (18)Boiling Point: 272.055 °C at 760 mmHg; (19)Vapour Pressure: 0.004 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: BrCc1cc(O)ccc1
(2)InChI: InChI=1/C7H7BrO/c8-5-6-2-1-3-7(9)4-6/h1-4,9H,5H2
(3)InChIKey: JHQONOCFAYZOEQ-UHFFFAOYAK