This product is an organic compound with the formula C₆H₃BrClNO₂. The systematic name of this chemical is 3-bromo-6-chloro-pyridine-2-carboxylic acid. With the CAS registry number 929000-66-8, it is also named as 2-pyridinecarboxylic acid, 3-bromo-6-chloro-. The product's categories are Blocks; Carboxes; Pyridines. In addition, the molecular weight is 236.45.

The other characteristics of 3-Bromo-6-chloro-2-pyridinecarboxylic acid can be summarized as: (1)ACD/LogP: 1.43; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 50.19 Å²; (7)Index of Refraction: 1.629; (8)Molar Refractivity: 43.85 cm³; (9)Molar Volume: 123.3 cm³; (10)Polarizability: 17.38×10^-24 cm³; (11)Surface Tension: 64.8 dyne/cm; (12)Density: 1.917 g/cm³; (13)Flash Point: 158.8 °C; (14)Enthalpy of Vaporization: 61.46 kJ/mol; (15)Boiling Point: 338.9 °C at 760 mmHg; (16)Vapour Pressure: 3.7E-05 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:c1cc(nc(c1Br)C(=O)O)Cl
2. InChI:InChI=1/C6H3BrClNO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11)
3. InChIKey:RDZPMWLHALUNCD-UHFFFAOYAI
4. Std. InChI:InChI=1S/C6H3BrClNO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11)
5. Std. InChIKey:RDZPMWLHALUNCD-UHFFFAOYSA-N