The CAS registry number of 3-Methoxy-6-methyl-4-nitro-6H-pyridazine 1-oxide is 4683-87-8. This chemical's molecular formula is C₆H₈N₃O₄ and molecular weight is 186.1449. What's more, its systematic name is called 3-Methoxy-6-methyl-4-nitro-1-oxo-1,6-dihydropyridazin-1-ium.

Physical properties about 3-Methoxy-6-methyl-4-nitro-6H-pyridazine 1-oxide are: (1)#H bond acceptors: 7; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 2; (4)Polar Surface Area: 87.49 Å².

Uses of 3-Methoxy-6-methyl-4-nitro-6H-pyridazine 1-oxide: it is used to produce other chemicals. For example, it is used to produce 4-Azido-3-methoxy-6-methyl-pyridazine 1-oxide.

The reaction needs reagent NaN₃ and solvents H₂O, Ethanol at the condition of heating. The yield is 78%.

You can still convert the following datas into molecular structure:
(1) SMILES: [O-][N+](=O)/C/1=C/C([N+](=O)\N=C\1\OC)C
(2) InChI: InChI=1/C6H8N3O4/c1-4-3-5(9(11)12)6(13-2)7-8(4)10/h3-4H,1-2H3/q+1
(3) InChIKey: VODXZQZLSWLSCY-UHFFFAOYAQ